About 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride
6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride (PubChem CID 21451341) has the molecular formula C12H15Cl2N5O
and a molecular weight of 316.19 g/mol. Its IUPAC name is 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride |
| PubChem CID | 21451341 |
| Molecular Formula | C12H15Cl2N5O |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride |
| SMILES | Cc1nc(NC2=NCCN2)nc2ccc(Cl)cc12.Cl.O |
| InChI | InChI=1S/C12H12ClN5.ClH.H2O/c1-7-9-6-8(13)2-3-10(9)17-12(16-7)18-11-14-4-5-15-11;;/h2-3,6H,4-5H2,1H3,(H2,14,15,16,17,18);1H;1H2 |
| InChIKey | PEHIOHNXSORAGS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride?
The IUPAC name of 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride (CID 21451341) is 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride.
What is the SMILES notation for 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride?
The canonical SMILES for 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride is Cc1nc(NC2=NCCN2)nc2ccc(Cl)cc12.Cl.O.
What is the InChIKey of 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride?
The InChIKey is PEHIOHNXSORAGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN5.ClH.H2O/c1-7-9-6-8(13)2-3-10(9)17-12(16-7)18-11-14-4-5-15-11;;/h2-3,6H,4-5H2,1H3,(H2,14,15,16,17,18);1H;1H2.
What are the key properties of 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride?
6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride has a molecular weight of 316.19 g/mol, XLogP of 1.56, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-4-methylquinazolin-2-amine;hydrate;hydrochloride is sourced from PubChem (CID 21451341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).