About 2,3-bis(but-2-ynyl)oxirane
2,3-bis(but-2-ynyl)oxirane (PubChem CID 21452223) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 2,3-bis(but-2-ynyl)oxirane.
Molecular Properties
| Compound Name | 2,3-bis(but-2-ynyl)oxirane |
| PubChem CID | 21452223 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 2,3-bis(but-2-ynyl)oxirane |
| SMILES | CC#CCC1OC1CC#CC |
| InChI | InChI=1S/C10H12O/c1-3-5-7-9-10(11-9)8-6-4-2/h9-10H,7-8H2,1-2H3 |
| InChIKey | LQTYRZIILKBZHD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(but-2-ynyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(but-2-ynyl)oxirane?
The IUPAC name of 2,3-bis(but-2-ynyl)oxirane (CID 21452223) is 2,3-bis(but-2-ynyl)oxirane.
What is the SMILES notation for 2,3-bis(but-2-ynyl)oxirane?
The canonical SMILES for 2,3-bis(but-2-ynyl)oxirane is CC#CCC1OC1CC#CC.
What is the InChIKey of 2,3-bis(but-2-ynyl)oxirane?
The InChIKey is LQTYRZIILKBZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-3-5-7-9-10(11-9)8-6-4-2/h9-10H,7-8H2,1-2H3.
What are the key properties of 2,3-bis(but-2-ynyl)oxirane?
2,3-bis(but-2-ynyl)oxirane has a molecular weight of 148.20 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(but-2-ynyl)oxirane is sourced from PubChem (CID 21452223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).