About 1,3-dioxan-2-yl carbamate
1,3-dioxan-2-yl carbamate (PubChem CID 21452255) has the molecular formula C5H9NO4
and a molecular weight of 147.13 g/mol. Its IUPAC name is 1,3-dioxan-2-yl carbamate.
Molecular Properties
| Compound Name | 1,3-dioxan-2-yl carbamate |
| PubChem CID | 21452255 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 1,3-dioxan-2-yl carbamate |
| SMILES | NC(=O)OC1OCCCO1 |
| InChI | InChI=1S/C5H9NO4/c6-4(7)10-5-8-2-1-3-9-5/h5H,1-3H2,(H2,6,7) |
| InChIKey | GQJNEBIZBDMWQC-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dioxan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxan-2-yl carbamate?
The IUPAC name of 1,3-dioxan-2-yl carbamate (CID 21452255) is 1,3-dioxan-2-yl carbamate.
What is the SMILES notation for 1,3-dioxan-2-yl carbamate?
The canonical SMILES for 1,3-dioxan-2-yl carbamate is NC(=O)OC1OCCCO1.
What is the InChIKey of 1,3-dioxan-2-yl carbamate?
The InChIKey is GQJNEBIZBDMWQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4/c6-4(7)10-5-8-2-1-3-9-5/h5H,1-3H2,(H2,6,7).
What are the key properties of 1,3-dioxan-2-yl carbamate?
1,3-dioxan-2-yl carbamate has a molecular weight of 147.13 g/mol, XLogP of -0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxan-2-yl carbamate is sourced from PubChem (CID 21452255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).