C19H22ClN5S2 — CID 2145265
2-[[5-butylsulfanyl-4-(4-chlorophenyl)-1,2,4-triazol-3-yl]methylsulfanyl]-4,6-dimethylpyrimidine (PubChem CID 2145265) has the molecular formula C19H22ClN5S2 and a molecular weight of 420.01 g/mol. Its IUPAC name is 2-[[5-butylsulfanyl-4-(4-chlorophenyl)-1,2,4-triazol-3-yl]methylsulfanyl]-4,6-dimethylpyrimidine.
| Compound Name | 2-[[5-butylsulfanyl-4-(4-chlorophenyl)-1,2,4-triazol-3-yl]methylsulfanyl]-4,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 2145265 |
| Molecular Formula | C19H22ClN5S2 |
| Molecular Weight | 420.01 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 2-[[5-butylsulfanyl-4-(4-chlorophenyl)-1,2,4-triazol-3-yl]methylsulfanyl]-4,6-dimethylpyrimidine |
| SMILES | CCCCSc1nnc(CSc2nc(C)cc(C)n2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClN5S2/c1-4-5-10-26-19-24-23-17(25(19)16-8-6-15(20)7-9-16)12-27-18-21-13(2)11-14(3)22-18/h6-9,11H,4-5,10,12H2,1-3H3 |
| InChIKey | UQYBWKCYZLPGEQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.01 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|