About 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane
2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane (PubChem CID 21453021) has the molecular formula C16H36N4
and a molecular weight of 284.49 g/mol. Its IUPAC name is 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane.
Molecular Properties
| Compound Name | 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane |
| PubChem CID | 21453021 |
| Molecular Formula | C16H36N4 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.29 |
| IUPAC Name | 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane |
| SMILES | N.N.NCCC1(C(CN)C2=CCCCC2)CCCCC1 |
| InChI | InChI=1S/C16H30N2.2H3N/c17-12-11-16(9-5-2-6-10-16)15(13-18)14-7-3-1-4-8-14;;/h7,15H,1-6,8-13,17-18H2;2*1H3 |
| InChIKey | ZFNYXAKNEISKKJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane?
The IUPAC name of 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane (CID 21453021) is 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane.
What is the SMILES notation for 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane?
The canonical SMILES for 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane is N.N.NCCC1(C(CN)C2=CCCCC2)CCCCC1.
What is the InChIKey of 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane?
The InChIKey is ZFNYXAKNEISKKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2.2H3N/c17-12-11-16(9-5-2-6-10-16)15(13-18)14-7-3-1-4-8-14;;/h7,15H,1-6,8-13,17-18H2;2*1H3.
What are the key properties of 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane?
2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane has a molecular weight of 284.49 g/mol, XLogP of 3.68, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-aminoethyl)cyclohexyl]-2-(cyclohexen-1-yl)ethanamine;azane is sourced from PubChem (CID 21453021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).