About 1H-indazol-7-ol
1H-indazol-7-ol (PubChem CID 21453601) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1H-indazol-7-ol.
Molecular Properties
| Compound Name | 1H-indazol-7-ol |
| PubChem CID | 21453601 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1H-indazol-7-ol |
| SMILES | Oc1cccc2cn[nH]c12 |
| InChI | InChI=1S/C7H6N2O/c10-6-3-1-2-5-4-8-9-7(5)6/h1-4,10H,(H,8,9) |
| InChIKey | VEDLFQPHHBOHIR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazol-7-ol?
The IUPAC name of 1H-indazol-7-ol (CID 21453601) is 1H-indazol-7-ol.
What is the SMILES notation for 1H-indazol-7-ol?
The canonical SMILES for 1H-indazol-7-ol is Oc1cccc2cn[nH]c12.
What is the InChIKey of 1H-indazol-7-ol?
The InChIKey is VEDLFQPHHBOHIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c10-6-3-1-2-5-4-8-9-7(5)6/h1-4,10H,(H,8,9).
What are the key properties of 1H-indazol-7-ol?
1H-indazol-7-ol has a molecular weight of 134.14 g/mol, XLogP of 1.27, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazol-7-ol is sourced from PubChem (CID 21453601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).