C18H25NO — CID 21453644
4-methoxy-1-methyl-11-prop-2-enyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-triene (PubChem CID 21453644) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 4-methoxy-1-methyl-11-prop-2-enyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-triene.
| Compound Name | 4-methoxy-1-methyl-11-prop-2-enyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 21453644 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 4-methoxy-1-methyl-11-prop-2-enyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-triene |
| SMILES | C=CCN1CCC2(C)CC(Cc3ccc(OC)cc32)C1 |
| InChI | InChI=1S/C18H25NO/c1-4-8-19-9-7-18(2)12-14(13-19)10-15-5-6-16(20-3)11-17(15)18/h4-6,11,14H,1,7-10,12-13H2,2-3H3 |
| InChIKey | VIUPYORBLJUQHP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|