C6H6Cl4 — CID 21454578
(2Z,4Z)-1,3,4,6-tetrachlorohexa-2,4-diene (PubChem CID 21454578) has the molecular formula C6H6Cl4 and a molecular weight of 219.93 g/mol. Its IUPAC name is (2Z,4Z)-1,3,4,6-tetrachlorohexa-2,4-diene.
| Compound Name | (2Z,4Z)-1,3,4,6-tetrachlorohexa-2,4-diene |
|---|---|
| PubChem CID | 21454578 |
| Molecular Formula | C6H6Cl4 |
| Molecular Weight | 219.93 g/mol |
| Exact Mass | 217.92 |
| IUPAC Name | (2Z,4Z)-1,3,4,6-tetrachlorohexa-2,4-diene |
| SMILES | ClC/C=C(Cl)/C(Cl)=C/CCl |
| InChI | InChI=1S/C6H6Cl4/c7-3-1-5(9)6(10)2-4-8/h1-2H,3-4H2/b5-1-,6-2- |
| InChIKey | KENIOSNCUYHRRA-IOBHVTPZSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.93 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|