C6H9N5OS2 — CID 21454632
2-methyl-4-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazolidin-3-one (PubChem CID 21454632) has the molecular formula C6H9N5OS2 and a molecular weight of 231.31 g/mol. Its IUPAC name is 2-methyl-4-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazolidin-3-one.
| Compound Name | 2-methyl-4-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 21454632 |
| Molecular Formula | C6H9N5OS2 |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 2-methyl-4-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-1,2,4-triazolidin-3-one |
| SMILES | CSc1nnc(N2CNN(C)C2=O)s1 |
| InChI | InChI=1S/C6H9N5OS2/c1-10-6(12)11(3-7-10)4-8-9-5(13-2)14-4/h7H,3H2,1-2H3 |
| InChIKey | IPBOCDGWHZEBHP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|