C18H34N4O2 — CID 21454717
1,2-bis(3,3,5,5-tetramethylpiperazin-1-yl)ethane-1,2-dione (PubChem CID 21454717) has the molecular formula C18H34N4O2 and a molecular weight of 338.50 g/mol. Its IUPAC name is 1,2-bis(3,3,5,5-tetramethylpiperazin-1-yl)ethane-1,2-dione.
| Compound Name | 1,2-bis(3,3,5,5-tetramethylpiperazin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 21454717 |
| Molecular Formula | C18H34N4O2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 1,2-bis(3,3,5,5-tetramethylpiperazin-1-yl)ethane-1,2-dione |
| SMILES | CC1(C)CN(C(=O)C(=O)N2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C18H34N4O2/c1-15(2)9-21(10-16(3,4)19-15)13(23)14(24)22-11-17(5,6)20-18(7,8)12-22/h19-20H,9-12H2,1-8H3 |
| InChIKey | HAVBUDRJKCECDT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|