About 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane
15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane (PubChem CID 21454737) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane.
Molecular Properties
| Compound Name | 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane |
| PubChem CID | 21454737 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane |
| SMILES | CN1CC2(CCCCC2)NC2(CCCCC2)C1 |
| InChI | InChI=1S/C15H28N2/c1-17-12-14(8-4-2-5-9-14)16-15(13-17)10-6-3-7-11-15/h16H,2-13H2,1H3 |
| InChIKey | PWSDZERKMALATP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane?
The IUPAC name of 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane (CID 21454737) is 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane.
What is the SMILES notation for 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane?
The canonical SMILES for 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane is CN1CC2(CCCCC2)NC2(CCCCC2)C1.
What is the InChIKey of 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane?
The InChIKey is PWSDZERKMALATP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2/c1-17-12-14(8-4-2-5-9-14)16-15(13-17)10-6-3-7-11-15/h16H,2-13H2,1H3.
What are the key properties of 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane?
15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane has a molecular weight of 236.40 g/mol, XLogP of 2.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 15-methyl-7,15-diazadispiro[5.1.58.36]hexadecane is sourced from PubChem (CID 21454737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).