diethyl(phenyl)stannanylium fluoride

C10H15FSn — CID 21455186

IUPACdiethyl(phenyl)stannanylium fluoride
SMILESCC[Sn+](CC)c1ccccc1.[F-]
InChIInChI=1S/C6H5.2C2H5.FH.Sn/c1-2-4-6-5-3-1;2*1-2;;/h1-5H;2*1H2,2H3;1H;/q;;;;+1/p-1
InChIKeySHCQVKVEIXXPJA-UHFFFAOYSA-M
MW272.94 g/mol
LogP-0.57
Rot. Bonds3

About diethyl(phenyl)stannanylium fluoride

diethyl(phenyl)stannanylium fluoride (PubChem CID 21455186) has the molecular formula C10H15FSn and a molecular weight of 272.94 g/mol. Its IUPAC name is diethyl(phenyl)stannanylium fluoride.

Molecular Properties

Compound Namediethyl(phenyl)stannanylium fluoride
PubChem CID21455186
Molecular FormulaC10H15FSn
Molecular Weight272.94 g/mol
Exact Mass274.02
IUPAC Namediethyl(phenyl)stannanylium fluoride
SMILESCC[Sn+](CC)c1ccccc1.[F-]
InChIInChI=1S/C6H5.2C2H5.FH.Sn/c1-2-4-6-5-3-1;2*1-2;;/h1-5H;2*1H2,2H3;1H;/q;;;;+1/p-1
InChIKeySHCQVKVEIXXPJA-UHFFFAOYSA-M
XLogP-0.57
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.94
LogP ≤ 5-0.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze diethyl(phenyl)stannanylium fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl(phenyl)stannanylium fluoride?
The IUPAC name of diethyl(phenyl)stannanylium fluoride (CID 21455186) is diethyl(phenyl)stannanylium fluoride.
What is the SMILES notation for diethyl(phenyl)stannanylium fluoride?
The canonical SMILES for diethyl(phenyl)stannanylium fluoride is CC[Sn+](CC)c1ccccc1.[F-].
What is the InChIKey of diethyl(phenyl)stannanylium fluoride?
The InChIKey is SHCQVKVEIXXPJA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5.2C2H5.FH.Sn/c1-2-4-6-5-3-1;2*1-2;;/h1-5H;2*1H2,2H3;1H;/q;;;;+1/p-1.
What are the key properties of diethyl(phenyl)stannanylium fluoride?
diethyl(phenyl)stannanylium fluoride has a molecular weight of 272.94 g/mol, XLogP of -0.57, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(phenyl)stannanylium fluoride is sourced from PubChem (CID 21455186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).