C13H12N2OS — CID 21455256
7,10-dimethyl-5H-thieno[3,4-b][1,5]benzodiazepin-4-one (PubChem CID 21455256) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is 7,10-dimethyl-5H-thieno[3,4-b][1,5]benzodiazepin-4-one.
| Compound Name | 7,10-dimethyl-5H-thieno[3,4-b][1,5]benzodiazepin-4-one |
|---|---|
| PubChem CID | 21455256 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 7,10-dimethyl-5H-thieno[3,4-b][1,5]benzodiazepin-4-one |
| SMILES | Cc1ccc2c(c1)NC(=O)c1cscc1N2C |
| InChI | InChI=1S/C13H12N2OS/c1-8-3-4-11-10(5-8)14-13(16)9-6-17-7-12(9)15(11)2/h3-7H,1-2H3,(H,14,16) |
| InChIKey | FUJMRELMFDHXPB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |