C9H13Cl3N4O2 — CID 21455355
[2,2,2-trichloro-1-(1,2,4-triazol-1-yl)ethyl] N-tert-butylcarbamate (PubChem CID 21455355) has the molecular formula C9H13Cl3N4O2 and a molecular weight of 315.59 g/mol. Its IUPAC name is [2,2,2-trichloro-1-(1,2,4-triazol-1-yl)ethyl] N-tert-butylcarbamate.
| Compound Name | [2,2,2-trichloro-1-(1,2,4-triazol-1-yl)ethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 21455355 |
| Molecular Formula | C9H13Cl3N4O2 |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | [2,2,2-trichloro-1-(1,2,4-triazol-1-yl)ethyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(n1cncn1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H13Cl3N4O2/c1-8(2,3)15-7(17)18-6(9(10,11)12)16-5-13-4-14-16/h4-6H,1-3H3,(H,15,17) |
| InChIKey | LIULSSFFNIXEIB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|