C17H19IN4O3S2 — CID 21455414
[1-methyl-2-oxo-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-4-yl] 4-iodobenzoate (PubChem CID 21455414) has the molecular formula C17H19IN4O3S2 and a molecular weight of 518.40 g/mol. Its IUPAC name is [1-methyl-2-oxo-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-4-yl] 4-iodobenzoate.
| Compound Name | [1-methyl-2-oxo-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-4-yl] 4-iodobenzoate |
|---|---|
| PubChem CID | 21455414 |
| Molecular Formula | C17H19IN4O3S2 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 517.99 |
| IUPAC Name | [1-methyl-2-oxo-3-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-1,3-diazinan-4-yl] 4-iodobenzoate |
| SMILES | CCCSc1nnc(N2C(=O)N(C)CCC2OC(=O)c2ccc(I)cc2)s1 |
| InChI | InChI=1S/C17H19IN4O3S2/c1-3-10-26-16-20-19-15(27-16)22-13(8-9-21(2)17(22)24)25-14(23)11-4-6-12(18)7-5-11/h4-7,13H,3,8-10H2,1-2H3 |
| InChIKey | WAQRVYFVHCQKRN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|