C20H22Cl4N4O3S — CID 21455419
[3-[5-(6-chlorohexyl)-1,3,4-thiadiazol-2-yl]-1-methyl-2-oxo-1,3-diazinan-4-yl] 3,4,5-trichlorobenzoate (PubChem CID 21455419) has the molecular formula C20H22Cl4N4O3S and a molecular weight of 540.30 g/mol. Its IUPAC name is [3-[5-(6-chlorohexyl)-1,3,4-thiadiazol-2-yl]-1-methyl-2-oxo-1,3-diazinan-4-yl] 3,4,5-trichlorobenzoate.
| Compound Name | [3-[5-(6-chlorohexyl)-1,3,4-thiadiazol-2-yl]-1-methyl-2-oxo-1,3-diazinan-4-yl] 3,4,5-trichlorobenzoate |
|---|---|
| PubChem CID | 21455419 |
| Molecular Formula | C20H22Cl4N4O3S |
| Molecular Weight | 540.30 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | [3-[5-(6-chlorohexyl)-1,3,4-thiadiazol-2-yl]-1-methyl-2-oxo-1,3-diazinan-4-yl] 3,4,5-trichlorobenzoate |
| SMILES | CN1CCC(OC(=O)c2cc(Cl)c(Cl)c(Cl)c2)N(c2nnc(CCCCCCCl)s2)C1=O |
| InChI | InChI=1S/C20H22Cl4N4O3S/c1-27-9-7-16(31-18(29)12-10-13(22)17(24)14(23)11-12)28(20(27)30)19-26-25-15(32-19)6-4-2-3-5-8-21/h10-11,16H,2-9H2,1H3 |
| InChIKey | RJAMYUBJCAKSSJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.30 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|