C17H17F3N4O4S2 — CID 21455421
[3-(5-ethylsulfinyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-(trifluoromethyl)benzoate (PubChem CID 21455421) has the molecular formula C17H17F3N4O4S2 and a molecular weight of 462.48 g/mol. Its IUPAC name is [3-(5-ethylsulfinyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [3-(5-ethylsulfinyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 21455421 |
| Molecular Formula | C17H17F3N4O4S2 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | [3-(5-ethylsulfinyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-(trifluoromethyl)benzoate |
| SMILES | CCS(=O)c1nnc(N2C(=O)N(C)CCC2OC(=O)c2ccc(C(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C17H17F3N4O4S2/c1-3-30(27)15-22-21-14(29-15)24-12(8-9-23(2)16(24)26)28-13(25)10-4-6-11(7-5-10)17(18,19)20/h4-7,12H,3,8-9H2,1-2H3 |
| InChIKey | YIUNPUZXGQZAHN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|