C22H30N4O4S — CID 21455438
[3-(5-butoxy-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-butylbenzoate (PubChem CID 21455438) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is [3-(5-butoxy-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-butylbenzoate.
| Compound Name | [3-(5-butoxy-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-butylbenzoate |
|---|---|
| PubChem CID | 21455438 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | [3-(5-butoxy-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-butylbenzoate |
| SMILES | CCCCOc1nnc(N2C(=O)N(C)CCC2OC(=O)c2ccc(CCCC)cc2)s1 |
| InChI | InChI=1S/C22H30N4O4S/c1-4-6-8-16-9-11-17(12-10-16)19(27)30-18-13-14-25(3)22(28)26(18)20-23-24-21(31-20)29-15-7-5-2/h9-12,18H,4-8,13-15H2,1-3H3 |
| InChIKey | AUIVHQRBZXLLCG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|