C20H25FN4O3S2 — CID 21455447
[3-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-fluorobenzoate (PubChem CID 21455447) has the molecular formula C20H25FN4O3S2 and a molecular weight of 452.58 g/mol. Its IUPAC name is [3-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-fluorobenzoate.
| Compound Name | [3-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 21455447 |
| Molecular Formula | C20H25FN4O3S2 |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [3-(5-hexylsulfanyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 4-fluorobenzoate |
| SMILES | CCCCCCSc1nnc(N2C(=O)N(C)CCC2OC(=O)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C20H25FN4O3S2/c1-3-4-5-6-13-29-19-23-22-18(30-19)25-16(11-12-24(2)20(25)27)28-17(26)14-7-9-15(21)10-8-14/h7-10,16H,3-6,11-13H2,1-2H3 |
| InChIKey | ZGHFBFGNWVYRGW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|