C21H27ClN4O5S2 — CID 21455457
[3-(5-hexylsulfonyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3-(chloromethyl)benzoate (PubChem CID 21455457) has the molecular formula C21H27ClN4O5S2 and a molecular weight of 515.06 g/mol. Its IUPAC name is [3-(5-hexylsulfonyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3-(chloromethyl)benzoate.
| Compound Name | [3-(5-hexylsulfonyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3-(chloromethyl)benzoate |
|---|---|
| PubChem CID | 21455457 |
| Molecular Formula | C21H27ClN4O5S2 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | [3-(5-hexylsulfonyl-1,3,4-thiadiazol-2-yl)-1-methyl-2-oxo-1,3-diazinan-4-yl] 3-(chloromethyl)benzoate |
| SMILES | CCCCCCS(=O)(=O)c1nnc(N2C(=O)N(C)CCC2OC(=O)c2cccc(CCl)c2)s1 |
| InChI | InChI=1S/C21H27ClN4O5S2/c1-3-4-5-6-12-33(29,30)20-24-23-19(32-20)26-17(10-11-25(2)21(26)28)31-18(27)16-9-7-8-15(13-16)14-22/h7-9,13,17H,3-6,10-12,14H2,1-2H3 |
| InChIKey | PCFAXOZMIABJBP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|