About 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium
2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium (PubChem CID 21455483) has the molecular formula C7H14Cl3N3O2
and a molecular weight of 278.57 g/mol. Its IUPAC name is 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium.
Molecular Properties
| Compound Name | 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium |
| PubChem CID | 21455483 |
| Molecular Formula | C7H14Cl3N3O2 |
| Molecular Weight | 278.57 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium |
| SMILES | C/N=C(\N)[N+](C)(C)C.O=C([O-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H14N3.C2HCl3O2/c1-7-5(6)8(2,3)4;3-2(4,5)1(6)7/h1-4H3,(H2,6,7);(H,6,7)/q+1;/p-1 |
| InChIKey | KTZNFGQMGBFSDH-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.57 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium?
The IUPAC name of 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium (CID 21455483) is 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium.
What is the SMILES notation for 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium?
The canonical SMILES for 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium is C/N=C(\N)[N+](C)(C)C.O=C([O-])C(Cl)(Cl)Cl.
What is the InChIKey of 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium?
The InChIKey is KTZNFGQMGBFSDH-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H14N3.C2HCl3O2/c1-7-5(6)8(2,3)4;3-2(4,5)1(6)7/h1-4H3,(H2,6,7);(H,6,7)/q+1;/p-1.
What are the key properties of 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium?
2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium has a molecular weight of 278.57 g/mol, XLogP of -0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloroacetate;trimethyl-(N'-methylcarbamimidoyl)azanium is sourced from PubChem (CID 21455483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).