C15H20F15NO3S — CID 21455515
1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate;tetraethylazanium (PubChem CID 21455515) has the molecular formula C15H20F15NO3S and a molecular weight of 579.37 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate;tetraethylazanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate;tetraethylazanium |
|---|---|
| PubChem CID | 21455515 |
| Molecular Formula | C15H20F15NO3S |
| Molecular Weight | 579.37 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H20N.C7HF15O3S/c1-5-9(6-2,7-3)8-4;8-1(9,2(10,11)4(14,15)6(18,19)20)3(12,13)5(16,17)7(21,22)26(23,24)25/h5-8H2,1-4H3;(H,23,24,25)/q+1;/p-1 |
| InChIKey | AVEHHQCKYJNKBA-UHFFFAOYSA-M |
| XLogP | 5.75 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.37 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|