C9H11N5 — CID 21455595
1-(4-methylphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 21455595) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 1-(4-methylphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(4-methylphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 21455595 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 1-(4-methylphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | Cc1ccc(-n2nc(N)nc2N)cc1 |
| InChI | InChI=1S/C9H11N5/c1-6-2-4-7(5-3-6)14-9(11)12-8(10)13-14/h2-5H,1H3,(H4,10,11,12,13) |
| InChIKey | PXDKMFJFKKOYCE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |