About [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate
[3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate (PubChem CID 21455596) has the molecular formula C15H15N3O3S2
and a molecular weight of 349.44 g/mol. Its IUPAC name is [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate.
Molecular Properties
| Compound Name | [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate |
| PubChem CID | 21455596 |
| Molecular Formula | C15H15N3O3S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate |
| SMILES | CN(C)c1cccc(OS(=O)(=O)c2ccc3nc(N)sc3c2)c1 |
| InChI | InChI=1S/C15H15N3O3S2/c1-18(2)10-4-3-5-11(8-10)21-23(19,20)12-6-7-13-14(9-12)22-15(16)17-13/h3-9H,1-2H3,(H2,16,17) |
| InChIKey | OSXAOWMOHUYSPG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate?
The IUPAC name of [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate (CID 21455596) is [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate.
What is the SMILES notation for [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate?
The canonical SMILES for [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate is CN(C)c1cccc(OS(=O)(=O)c2ccc3nc(N)sc3c2)c1.
What is the InChIKey of [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate?
The InChIKey is OSXAOWMOHUYSPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O3S2/c1-18(2)10-4-3-5-11(8-10)21-23(19,20)12-6-7-13-14(9-12)22-15(16)17-13/h3-9H,1-2H3,(H2,16,17).
What are the key properties of [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate?
[3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate has a molecular weight of 349.44 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(dimethylamino)phenyl] 2-amino-1,3-benzothiazole-6-sulfonate is sourced from PubChem (CID 21455596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).