About 6-N-phenyl-1,3-benzothiazole-2,6-diamine
6-N-phenyl-1,3-benzothiazole-2,6-diamine (PubChem CID 21455645) has the molecular formula C13H11N3S
and a molecular weight of 241.32 g/mol. Its IUPAC name is 6-N-phenyl-1,3-benzothiazole-2,6-diamine.
Molecular Properties
| Compound Name | 6-N-phenyl-1,3-benzothiazole-2,6-diamine |
| PubChem CID | 21455645 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 6-N-phenyl-1,3-benzothiazole-2,6-diamine |
| SMILES | Nc1nc2ccc(Nc3ccccc3)cc2s1 |
| InChI | InChI=1S/C13H11N3S/c14-13-16-11-7-6-10(8-12(11)17-13)15-9-4-2-1-3-5-9/h1-8,15H,(H2,14,16) |
| InChIKey | UMJPQOAGYIRHCE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-N-phenyl-1,3-benzothiazole-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-phenyl-1,3-benzothiazole-2,6-diamine?
The IUPAC name of 6-N-phenyl-1,3-benzothiazole-2,6-diamine (CID 21455645) is 6-N-phenyl-1,3-benzothiazole-2,6-diamine.
What is the SMILES notation for 6-N-phenyl-1,3-benzothiazole-2,6-diamine?
The canonical SMILES for 6-N-phenyl-1,3-benzothiazole-2,6-diamine is Nc1nc2ccc(Nc3ccccc3)cc2s1.
What is the InChIKey of 6-N-phenyl-1,3-benzothiazole-2,6-diamine?
The InChIKey is UMJPQOAGYIRHCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3S/c14-13-16-11-7-6-10(8-12(11)17-13)15-9-4-2-1-3-5-9/h1-8,15H,(H2,14,16).
What are the key properties of 6-N-phenyl-1,3-benzothiazole-2,6-diamine?
6-N-phenyl-1,3-benzothiazole-2,6-diamine has a molecular weight of 241.32 g/mol, XLogP of 3.62, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-phenyl-1,3-benzothiazole-2,6-diamine is sourced from PubChem (CID 21455645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).