About 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one
1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one (PubChem CID 21455794) has the molecular formula C11H6Cl2F6N2O
and a molecular weight of 367.08 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one.
Molecular Properties
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one |
| PubChem CID | 21455794 |
| Molecular Formula | C11H6Cl2F6N2O |
| Molecular Weight | 367.08 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one |
| SMILES | CC(=O)C(Cl)(Cl)/N=N/c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H6Cl2F6N2O/c1-5(22)9(12,13)21-20-8-3-6(10(14,15)16)2-7(4-8)11(17,18)19/h2-4H,1H3/b21-20+ |
| InChIKey | RCCBEMJJLGDYNJ-QZQOTICOSA-N |
| XLogP | 5.53 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.08 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one?
The IUPAC name of 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one (CID 21455794) is 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one.
What is the SMILES notation for 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one?
The canonical SMILES for 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one is CC(=O)C(Cl)(Cl)/N=N/c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one?
The InChIKey is RCCBEMJJLGDYNJ-QZQOTICOSA-N. The full InChI is InChI=1S/C11H6Cl2F6N2O/c1-5(22)9(12,13)21-20-8-3-6(10(14,15)16)2-7(4-8)11(17,18)19/h2-4H,1H3/b21-20+.
What are the key properties of 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one?
1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one has a molecular weight of 367.08 g/mol, XLogP of 5.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3,5-bis(trifluoromethyl)phenyl]diazenyl]-1,1-dichloropropan-2-one is sourced from PubChem (CID 21455794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).