C16H20N8O2 — CID 21455982
N-(4-methylcyclohexyl)-3-(1-methyl-5-nitroimidazol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 21455982) has the molecular formula C16H20N8O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-3-(1-methyl-5-nitroimidazol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(4-methylcyclohexyl)-3-(1-methyl-5-nitroimidazol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 21455982 |
| Molecular Formula | C16H20N8O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-(4-methylcyclohexyl)-3-(1-methyl-5-nitroimidazol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CC1CCC(Nc2ccc3nnc(-c4ncc([N+](=O)[O-])n4C)n3n2)CC1 |
| InChI | InChI=1S/C16H20N8O2/c1-10-3-5-11(6-4-10)18-12-7-8-13-19-20-16(23(13)21-12)15-17-9-14(22(15)2)24(25)26/h7-11H,3-6H2,1-2H3,(H,18,21) |
| InChIKey | HYZIVSMSYHIRGH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|