C16H21N9O2 — CID 21455990
N'-[3-(1-methyl-5-nitroimidazol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N-dipropylmethanimidamide (PubChem CID 21455990) has the molecular formula C16H21N9O2 and a molecular weight of 371.41 g/mol. Its IUPAC name is N'-[3-(1-methyl-5-nitroimidazol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N-dipropylmethanimidamide.
| Compound Name | N'-[3-(1-methyl-5-nitroimidazol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N-dipropylmethanimidamide |
|---|---|
| PubChem CID | 21455990 |
| Molecular Formula | C16H21N9O2 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N'-[3-(1-methyl-5-nitroimidazol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N,N-dipropylmethanimidamide |
| SMILES | CCCN(/C=N/c1ccc2nnc(-c3ncc([N+](=O)[O-])n3C)n2n1)CCC |
| InChI | InChI=1S/C16H21N9O2/c1-4-8-23(9-5-2)11-18-12-6-7-13-19-20-16(24(13)21-12)15-17-10-14(22(15)3)25(26)27/h6-7,10-11H,4-5,8-9H2,1-3H3/b18-11+ |
| InChIKey | SGODSNCUAWANCG-WOJGMQOQSA-N |
| XLogP | 2.21 |
| TPSA | 119.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|