C50H42N4O2Zn — CID 21456666
zinc (3E,5Z)-2,2,7,7-tetramethyl-4-(10,15,20-triphenylporphyrin-5-yl)octa-3,5-diene-3,6-diolate (PubChem CID 21456666) has the molecular formula C50H42N4O2Zn and a molecular weight of 796.30 g/mol. Its IUPAC name is zinc (3E,5Z)-2,2,7,7-tetramethyl-4-(10,15,20-triphenylporphyrin-5-yl)octa-3,5-diene-3,6-diolate.
| Compound Name | zinc (3E,5Z)-2,2,7,7-tetramethyl-4-(10,15,20-triphenylporphyrin-5-yl)octa-3,5-diene-3,6-diolate |
|---|---|
| PubChem CID | 21456666 |
| Molecular Formula | C50H42N4O2Zn |
| Molecular Weight | 796.30 g/mol |
| Exact Mass | 794.26 |
| IUPAC Name | zinc (3E,5Z)-2,2,7,7-tetramethyl-4-(10,15,20-triphenylporphyrin-5-yl)octa-3,5-diene-3,6-diolate |
| SMILES | CC(C)(C)/C([O-])=C/C(/C1=C2\C=CC(=N2)/C(c2ccccc2)=C2/C=CC(=N2)/C(c2ccccc2)=C2/C=CC(=N2)/C(c2ccccc2)=C2C=C/C1=N/2)=C(\[O-])C(C)(C)C.[Zn+2] |
| InChI | InChI=1S/C50H44N4O2.Zn/c1-49(2,3)43(55)30-34(48(56)50(4,5)6)47-41-28-26-39(53-41)45(32-18-12-8-13-19-32)37-24-22-35(51-37)44(31-16-10-7-11-17-31)36-23-25-38(52-36)46(33-20-14-9-15-21-33)40-27-29-42(47)54-40;/h7-30,55-56H,1-6H3;/q;+2/p-2/b43-30-,44-35-,44-36-,45-37-,45-39-,46-38-,46-40-,47-41-,47-42-,48-34+; |
| InChIKey | KYGAGAQPLBXFSJ-DRPFCTIRSA-L |
| XLogP | 9.48 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.30 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|