C6H8N2O2S — CID 21458513
ethyl 2-(1,2,4-thiadiazol-3-yl)acetate (PubChem CID 21458513) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is ethyl 2-(1,2,4-thiadiazol-3-yl)acetate.
| Compound Name | ethyl 2-(1,2,4-thiadiazol-3-yl)acetate |
|---|---|
| PubChem CID | 21458513 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | ethyl 2-(1,2,4-thiadiazol-3-yl)acetate |
| SMILES | CCOC(=O)Cc1ncsn1 |
| InChI | InChI=1S/C6H8N2O2S/c1-2-10-6(9)3-5-7-4-11-8-5/h4H,2-3H2,1H3 |
| InChIKey | WZNPWENBYXMAHZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |