About 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium
2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium (PubChem CID 21458934) has the molecular formula C26H32F3N3O3S2
and a molecular weight of 555.69 g/mol. Its IUPAC name is 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium |
| PubChem CID | 21458934 |
| Molecular Formula | C26H32F3N3O3S2 |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium |
| SMILES | CN(C)c1ccc([S+](c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1.O=S(=O)([O-])CC(F)(F)F |
| InChI | InChI=1S/C24H30N3S.C2H3F3O3S/c1-25(2)19-7-13-22(14-8-19)28(23-15-9-20(10-16-23)26(3)4)24-17-11-21(12-18-24)27(5)6;3-2(4,5)1-9(6,7)8/h7-18H,1-6H3;1H2,(H,6,7,8)/q+1;/p-1 |
| InChIKey | COMNEQMKEGIXBI-UHFFFAOYSA-M |
| XLogP | 5.07 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium?
The IUPAC name of 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium (CID 21458934) is 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium.
What is the SMILES notation for 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium?
The canonical SMILES for 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium is CN(C)c1ccc([S+](c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1.O=S(=O)([O-])CC(F)(F)F.
What is the InChIKey of 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium?
The InChIKey is COMNEQMKEGIXBI-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H30N3S.C2H3F3O3S/c1-25(2)19-7-13-22(14-8-19)28(23-15-9-20(10-16-23)26(3)4)24-17-11-21(12-18-24)27(5)6;3-2(4,5)1-9(6,7)8/h7-18H,1-6H3;1H2,(H,6,7,8)/q+1;/p-1.
What are the key properties of 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium?
2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium has a molecular weight of 555.69 g/mol, XLogP of 5.07, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethanesulfonate;tris[4-(dimethylamino)phenyl]sulfanium is sourced from PubChem (CID 21458934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).