C13H8ClNO5 — CID 21459125
(3-chlorophenyl)-(3,4-dihydroxy-5-nitrophenyl)methanone (PubChem CID 21459125) has the molecular formula C13H8ClNO5 and a molecular weight of 293.66 g/mol. Its IUPAC name is (3-chlorophenyl)-(3,4-dihydroxy-5-nitrophenyl)methanone.
| Compound Name | (3-chlorophenyl)-(3,4-dihydroxy-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 21459125 |
| Molecular Formula | C13H8ClNO5 |
| Molecular Weight | 293.66 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | (3-chlorophenyl)-(3,4-dihydroxy-5-nitrophenyl)methanone |
| SMILES | O=C(c1cccc(Cl)c1)c1cc(O)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H8ClNO5/c14-9-3-1-2-7(4-9)12(17)8-5-10(15(19)20)13(18)11(16)6-8/h1-6,16,18H |
| InChIKey | IFHMOMOAMKIDLZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.66 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|