About 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane
3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane (PubChem CID 21459254) has the molecular formula C5H5ClF6
and a molecular weight of 214.54 g/mol. Its IUPAC name is 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane.
Molecular Properties
| Compound Name | 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane |
| PubChem CID | 21459254 |
| Molecular Formula | C5H5ClF6 |
| Molecular Weight | 214.54 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane |
| SMILES | CC(Cl)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H5ClF6/c1-2(6)3(4(7,8)9)5(10,11)12/h2-3H,1H3 |
| InChIKey | OMCHASYDEGILRM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane?
The IUPAC name of 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane (CID 21459254) is 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane.
What is the SMILES notation for 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane?
The canonical SMILES for 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane is CC(Cl)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane?
The InChIKey is OMCHASYDEGILRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClF6/c1-2(6)3(4(7,8)9)5(10,11)12/h2-3H,1H3.
What are the key properties of 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane?
3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane has a molecular weight of 214.54 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane is sourced from PubChem (CID 21459254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).