About 1-chloro-3,3-difluoroprop-1-yne
1-chloro-3,3-difluoroprop-1-yne (PubChem CID 21459291) has the molecular formula C3HClF2
and a molecular weight of 110.49 g/mol. Its IUPAC name is 1-chloro-3,3-difluoroprop-1-yne.
Molecular Properties
| Compound Name | 1-chloro-3,3-difluoroprop-1-yne |
| PubChem CID | 21459291 |
| Molecular Formula | C3HClF2 |
| Molecular Weight | 110.49 g/mol |
| Exact Mass | 109.97 |
| IUPAC Name | 1-chloro-3,3-difluoroprop-1-yne |
| SMILES | FC(F)C#CCl |
| InChI | InChI=1S/C3HClF2/c4-2-1-3(5)6/h3H |
| InChIKey | MTVIIZLKVURCHQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3,3-difluoroprop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3,3-difluoroprop-1-yne?
The IUPAC name of 1-chloro-3,3-difluoroprop-1-yne (CID 21459291) is 1-chloro-3,3-difluoroprop-1-yne.
What is the SMILES notation for 1-chloro-3,3-difluoroprop-1-yne?
The canonical SMILES for 1-chloro-3,3-difluoroprop-1-yne is FC(F)C#CCl.
What is the InChIKey of 1-chloro-3,3-difluoroprop-1-yne?
The InChIKey is MTVIIZLKVURCHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3HClF2/c4-2-1-3(5)6/h3H.
What are the key properties of 1-chloro-3,3-difluoroprop-1-yne?
1-chloro-3,3-difluoroprop-1-yne has a molecular weight of 110.49 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3,3-difluoroprop-1-yne is sourced from PubChem (CID 21459291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).