C10H14F3NO3 — CID 21459534
2-(2,2-diethoxyethyl)-4,4,4-trifluoro-3-oxobutanenitrile (PubChem CID 21459534) has the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyl)-4,4,4-trifluoro-3-oxobutanenitrile.
| Compound Name | 2-(2,2-diethoxyethyl)-4,4,4-trifluoro-3-oxobutanenitrile |
|---|---|
| PubChem CID | 21459534 |
| Molecular Formula | C10H14F3NO3 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(2,2-diethoxyethyl)-4,4,4-trifluoro-3-oxobutanenitrile |
| SMILES | CCOC(CC(C#N)C(=O)C(F)(F)F)OCC |
| InChI | InChI=1S/C10H14F3NO3/c1-3-16-8(17-4-2)5-7(6-14)9(15)10(11,12)13/h7-8H,3-5H2,1-2H3 |
| InChIKey | CWNIAURETMLVLT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|