About 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile
3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile (PubChem CID 21459535) has the molecular formula C7H3Br2N3
and a molecular weight of 288.93 g/mol. Its IUPAC name is 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile.
Molecular Properties
| Compound Name | 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile |
| PubChem CID | 21459535 |
| Molecular Formula | C7H3Br2N3 |
| Molecular Weight | 288.93 g/mol |
| Exact Mass | 286.87 |
| IUPAC Name | 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile |
| SMILES | Cn1c(Br)c(C#N)c(Br)c1C#N |
| InChI | InChI=1S/C7H3Br2N3/c1-12-5(3-11)6(8)4(2-10)7(12)9/h1H3 |
| InChIKey | JPNJRIBXMFTIPT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.93 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile?
The IUPAC name of 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile (CID 21459535) is 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile.
What is the SMILES notation for 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile?
The canonical SMILES for 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile is Cn1c(Br)c(C#N)c(Br)c1C#N.
What is the InChIKey of 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile?
The InChIKey is JPNJRIBXMFTIPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Br2N3/c1-12-5(3-11)6(8)4(2-10)7(12)9/h1H3.
What are the key properties of 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile?
3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile has a molecular weight of 288.93 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-1-methylpyrrole-2,4-dicarbonitrile is sourced from PubChem (CID 21459535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).