C33H54O7 — CID 21459811
2-methyl-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxyoxane-3,4,5-triol (PubChem CID 21459811) has the molecular formula C33H54O7 and a molecular weight of 562.79 g/mol. Its IUPAC name is 2-methyl-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxyoxane-3,4,5-triol.
| Compound Name | 2-methyl-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 21459811 |
| Molecular Formula | C33H54O7 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | 2-methyl-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl)oxyoxane-3,4,5-triol |
| SMILES | CC1CCC2(OC1)OC1CC3C4CCC5CC(OC6OC(C)C(O)C(O)C6O)CCC5(C)C4CCC3(C)C1C2C |
| InChI | InChI=1S/C33H54O7/c1-17-8-13-33(37-16-17)18(2)26-25(40-33)15-24-22-7-6-20-14-21(39-30-29(36)28(35)27(34)19(3)38-30)9-11-31(20,4)23(22)10-12-32(24,26)5/h17-30,34-36H,6-16H2,1-5H3 |
| InChIKey | DFKNLZAVFFVGTH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|