About 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid
2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid (PubChem CID 21459849) has the molecular formula C4H2F3NO3S2
and a molecular weight of 233.19 g/mol. Its IUPAC name is 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid |
| PubChem CID | 21459849 |
| Molecular Formula | C4H2F3NO3S2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 232.94 |
| IUPAC Name | 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid |
| SMILES | O=S(=O)(O)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C4H2F3NO3S2/c5-4(6,7)3-8-1-2(12-3)13(9,10)11/h1H,(H,9,10,11) |
| InChIKey | KGGMNYVPSQHELG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid?
The IUPAC name of 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid (CID 21459849) is 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid.
What is the SMILES notation for 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid?
The canonical SMILES for 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid is O=S(=O)(O)c1cnc(C(F)(F)F)s1.
What is the InChIKey of 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid?
The InChIKey is KGGMNYVPSQHELG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2F3NO3S2/c5-4(6,7)3-8-1-2(12-3)13(9,10)11/h1H,(H,9,10,11).
What are the key properties of 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid?
2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid has a molecular weight of 233.19 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)-1,3-thiazole-5-sulfonic acid is sourced from PubChem (CID 21459849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).