C19H19N2O5- — CID 2146009
(2S)-2-[[(2S)-3-carbazol-9-yl-2-hydroxypropyl]azaniumyl]butanedioate (PubChem CID 2146009) has the molecular formula C19H19N2O5- and a molecular weight of 355.37 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-carbazol-9-yl-2-hydroxypropyl]azaniumyl]butanedioate.
| Compound Name | (2S)-2-[[(2S)-3-carbazol-9-yl-2-hydroxypropyl]azaniumyl]butanedioate |
|---|---|
| PubChem CID | 2146009 |
| Molecular Formula | C19H19N2O5- |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (2S)-2-[[(2S)-3-carbazol-9-yl-2-hydroxypropyl]azaniumyl]butanedioate |
| SMILES | O=C([O-])C[C@H]([NH2+]C[C@H](O)Cn1c2ccccc2c2ccccc21)C(=O)[O-] |
| InChI | InChI=1S/C19H20N2O5/c22-12(10-20-15(19(25)26)9-18(23)24)11-21-16-7-3-1-5-13(16)14-6-2-4-8-17(14)21/h1-8,12,15,20,22H,9-11H2,(H,23,24)(H,25,26)/p-1/t12-,15-/m0/s1 |
| InChIKey | STHFIPLOWBFUDJ-WFASDCNBSA-M |
| XLogP | -2.02 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |