About 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate
1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate (PubChem CID 21460758) has the molecular formula C25H27N3O7
and a molecular weight of 481.51 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate |
| PubChem CID | 21460758 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1c(NCCC(=O)c2ccccc2)c2ccc([N+](=O)[O-])cc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H27N3O7/c1-5-34-23(30)22-21(26-14-13-20(29)16-9-7-6-8-10-16)18-12-11-17(28(32)33)15-19(18)27(22)24(31)35-25(2,3)4/h6-12,15,26H,5,13-14H2,1-4H3 |
| InChIKey | VENGDVBYJDQNNU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate (CID 21460758) is 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate is CCOC(=O)c1c(NCCC(=O)c2ccccc2)c2ccc([N+](=O)[O-])cc2n1C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate?
The InChIKey is VENGDVBYJDQNNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O7/c1-5-34-23(30)22-21(26-14-13-20(29)16-9-7-6-8-10-16)18-12-11-17(28(32)33)15-19(18)27(22)24(31)35-25(2,3)4/h6-12,15,26H,5,13-14H2,1-4H3.
What are the key properties of 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate?
1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate has a molecular weight of 481.51 g/mol, XLogP of 5.19, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 2-O-ethyl 6-nitro-3-[(3-oxo-3-phenylpropyl)amino]indole-1,2-dicarboxylate is sourced from PubChem (CID 21460758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).