About 7-methoxy-2,2-dimethyl-6-nitrochromene
7-methoxy-2,2-dimethyl-6-nitrochromene (PubChem CID 21460858) has the molecular formula C12H13NO4
and a molecular weight of 235.24 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethyl-6-nitrochromene.
Molecular Properties
| Compound Name | 7-methoxy-2,2-dimethyl-6-nitrochromene |
| PubChem CID | 21460858 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 7-methoxy-2,2-dimethyl-6-nitrochromene |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])C=CC(C)(C)O2 |
| InChI | InChI=1S/C12H13NO4/c1-12(2)5-4-8-6-9(13(14)15)11(16-3)7-10(8)17-12/h4-7H,1-3H3 |
| InChIKey | XNNKQPKMNWZHSM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-2,2-dimethyl-6-nitrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2,2-dimethyl-6-nitrochromene?
The IUPAC name of 7-methoxy-2,2-dimethyl-6-nitrochromene (CID 21460858) is 7-methoxy-2,2-dimethyl-6-nitrochromene.
What is the SMILES notation for 7-methoxy-2,2-dimethyl-6-nitrochromene?
The canonical SMILES for 7-methoxy-2,2-dimethyl-6-nitrochromene is COc1cc2c(cc1[N+](=O)[O-])C=CC(C)(C)O2.
What is the InChIKey of 7-methoxy-2,2-dimethyl-6-nitrochromene?
The InChIKey is XNNKQPKMNWZHSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4/c1-12(2)5-4-8-6-9(13(14)15)11(16-3)7-10(8)17-12/h4-7H,1-3H3.
What are the key properties of 7-methoxy-2,2-dimethyl-6-nitrochromene?
7-methoxy-2,2-dimethyl-6-nitrochromene has a molecular weight of 235.24 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2,2-dimethyl-6-nitrochromene is sourced from PubChem (CID 21460858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).