About 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine
2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine (PubChem CID 21460973) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine |
| PubChem CID | 21460973 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine |
| SMILES | CCc1ccc2c(c1)C(CCN)CO2 |
| InChI | InChI=1S/C12H17NO/c1-2-9-3-4-12-11(7-9)10(5-6-13)8-14-12/h3-4,7,10H,2,5-6,8,13H2,1H3 |
| InChIKey | WXNJBUZGZZOMCY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine?
The IUPAC name of 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine (CID 21460973) is 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine.
What is the SMILES notation for 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine?
The canonical SMILES for 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine is CCc1ccc2c(c1)C(CCN)CO2.
What is the InChIKey of 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine?
The InChIKey is WXNJBUZGZZOMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-2-9-3-4-12-11(7-9)10(5-6-13)8-14-12/h3-4,7,10H,2,5-6,8,13H2,1H3.
What are the key properties of 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine?
2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine has a molecular weight of 191.27 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethyl-2,3-dihydro-1-benzofuran-3-yl)ethanamine is sourced from PubChem (CID 21460973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).