About CID 21461896
CID 21461896 (PubChem CID 21461896) has the molecular formula C6H15Si3
and a molecular weight of 171.44 g/mol.
Molecular Properties
| Compound Name | CID 21461896 |
| PubChem CID | 21461896 |
| Molecular Formula | C6H15Si3 |
| Molecular Weight | 171.44 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C)[Si][Si] |
| InChI | InChI=1S/C6H15Si3/c1-6(2,3)9(4,5)8-7/h1-5H3 |
| InChIKey | KJHJRPXNFPHGEJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 21461896 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21461896?
The IUPAC name of CID 21461896 (CID 21461896) is not available.
What is the SMILES notation for CID 21461896?
The canonical SMILES for CID 21461896 is CC(C)(C)[Si](C)(C)[Si][Si].
What is the InChIKey of CID 21461896?
The InChIKey is KJHJRPXNFPHGEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15Si3/c1-6(2,3)9(4,5)8-7/h1-5H3.
What are the key properties of CID 21461896?
CID 21461896 has a molecular weight of 171.44 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21461896 is sourced from PubChem (CID 21461896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).