About CID 21461966
CID 21461966 (PubChem CID 21461966) has the molecular formula C12H27Si3
and a molecular weight of 255.61 g/mol.
Molecular Properties
| Compound Name | CID 21461966 |
| PubChem CID | 21461966 |
| Molecular Formula | C12H27Si3 |
| Molecular Weight | 255.61 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]([Si][Si])(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H27Si3/c1-10(2,3)15(14-13,11(4,5)6)12(7,8)9/h1-9H3 |
| InChIKey | YUVWMQMFEDBAOF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 21461966 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21461966?
The IUPAC name of CID 21461966 (CID 21461966) is not available.
What is the SMILES notation for CID 21461966?
The canonical SMILES for CID 21461966 is CC(C)(C)[Si]([Si][Si])(C(C)(C)C)C(C)(C)C.
What is the InChIKey of CID 21461966?
The InChIKey is YUVWMQMFEDBAOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27Si3/c1-10(2,3)15(14-13,11(4,5)6)12(7,8)9/h1-9H3.
What are the key properties of CID 21461966?
CID 21461966 has a molecular weight of 255.61 g/mol, XLogP of 4.12, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21461966 is sourced from PubChem (CID 21461966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).