C19H22N2O2S — CID 2146267
(3aR,7aR)-2-[(4-ethoxy-3-methoxyphenyl)methylideneamino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carbonitrile (PubChem CID 2146267) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is (3aR,7aR)-2-[(4-ethoxy-3-methoxyphenyl)methylideneamino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (3aR,7aR)-2-[(4-ethoxy-3-methoxyphenyl)methylideneamino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 2146267 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (3aR,7aR)-2-[(4-ethoxy-3-methoxyphenyl)methylideneamino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CCOc1ccc(C=NC2=C(C#N)[C@H]3CCCC[C@H]3S2)cc1OC |
| InChI | InChI=1S/C19H22N2O2S/c1-3-23-16-9-8-13(10-17(16)22-2)12-21-19-15(11-20)14-6-4-5-7-18(14)24-19/h8-10,12,14,18H,3-7H2,1-2H3/t14-,18-/m1/s1 |
| InChIKey | BNYMNUMUBJTVOL-RDTXWAMCSA-N |
| XLogP | 4.55 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|