About 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione
11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione (PubChem CID 21463125) has the molecular formula C19H15NO2
and a molecular weight of 289.33 g/mol. Its IUPAC name is 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione.
Molecular Properties
| Compound Name | 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione |
| PubChem CID | 21463125 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione |
| SMILES | O=C1CCCn2c1c(-c1ccccc1)c1ccccc1c2=O |
| InChI | InChI=1S/C19H15NO2/c21-16-11-6-12-20-18(16)17(13-7-2-1-3-8-13)14-9-4-5-10-15(14)19(20)22/h1-5,7-10H,6,11-12H2 |
| InChIKey | CIIAJBPJUBTEJM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione?
The IUPAC name of 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione (CID 21463125) is 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione.
What is the SMILES notation for 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione?
The canonical SMILES for 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione is O=C1CCCn2c1c(-c1ccccc1)c1ccccc1c2=O.
What is the InChIKey of 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione?
The InChIKey is CIIAJBPJUBTEJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO2/c21-16-11-6-12-20-18(16)17(13-7-2-1-3-8-13)14-9-4-5-10-15(14)19(20)22/h1-5,7-10H,6,11-12H2.
What are the key properties of 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione?
11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione has a molecular weight of 289.33 g/mol, XLogP of 3.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-phenyl-3,4-dihydro-2H-benzo[g]quinolizine-1,6-dione is sourced from PubChem (CID 21463125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).