C16H8BrF3N2S — CID 21463499
2-[3-bromo-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]phenyl]acetonitrile (PubChem CID 21463499) has the molecular formula C16H8BrF3N2S and a molecular weight of 397.22 g/mol. Its IUPAC name is 2-[3-bromo-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]phenyl]acetonitrile.
| Compound Name | 2-[3-bromo-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 21463499 |
| Molecular Formula | C16H8BrF3N2S |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | 2-[3-bromo-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]phenyl]acetonitrile |
| SMILES | N#CCc1cc(Br)cc(Cc2nc3c(F)c(F)cc(F)c3s2)c1 |
| InChI | InChI=1S/C16H8BrF3N2S/c17-10-4-8(1-2-21)3-9(5-10)6-13-22-15-14(20)11(18)7-12(19)16(15)23-13/h3-5,7H,1,6H2 |
| InChIKey | FFOVLLUVLWWKFY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|