C17H10F3NO4S — CID 21463517
3-(carboxymethyl)-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]benzoic acid (PubChem CID 21463517) has the molecular formula C17H10F3NO4S and a molecular weight of 381.33 g/mol. Its IUPAC name is 3-(carboxymethyl)-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]benzoic acid.
| Compound Name | 3-(carboxymethyl)-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 21463517 |
| Molecular Formula | C17H10F3NO4S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 3-(carboxymethyl)-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]benzoic acid |
| SMILES | O=C(O)Cc1cc(Cc2nc3c(F)c(F)cc(F)c3s2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C17H10F3NO4S/c18-10-6-11(19)16-15(14(10)20)21-12(26-16)4-7-1-8(5-13(22)23)3-9(2-7)17(24)25/h1-3,6H,4-5H2,(H,22,23)(H,24,25) |
| InChIKey | HPZZACPEVVDIGK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|