C13H11F3N2O3S — CID 21463526
2-[methyl-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanoyl]amino]acetic acid (PubChem CID 21463526) has the molecular formula C13H11F3N2O3S and a molecular weight of 332.30 g/mol. Its IUPAC name is 2-[methyl-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 21463526 |
| Molecular Formula | C13H11F3N2O3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-[methyl-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanoyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)CCc1nc2c(F)c(F)cc(F)c2s1 |
| InChI | InChI=1S/C13H11F3N2O3S/c1-18(5-10(20)21)9(19)3-2-8-17-12-11(16)6(14)4-7(15)13(12)22-8/h4H,2-3,5H2,1H3,(H,20,21) |
| InChIKey | XOGMYASVWNUFQA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|