C19H15F3N2O3S — CID 21463530
2-[benzyl-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanoyl]amino]acetic acid (PubChem CID 21463530) has the molecular formula C19H15F3N2O3S and a molecular weight of 408.40 g/mol. Its IUPAC name is 2-[benzyl-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanoyl]amino]acetic acid.
| Compound Name | 2-[benzyl-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 21463530 |
| Molecular Formula | C19H15F3N2O3S |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-[benzyl-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanoyl]amino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccccc1)C(=O)CCc1nc2c(F)c(F)cc(F)c2s1 |
| InChI | InChI=1S/C19H15F3N2O3S/c20-12-8-13(21)19-18(17(12)22)23-14(28-19)6-7-15(25)24(10-16(26)27)9-11-4-2-1-3-5-11/h1-5,8H,6-7,9-10H2,(H,26,27) |
| InChIKey | SNQXOMFMLUUZRK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|